C18H32N6O2 — CID 110048000
N,N-dimethyl-2-[[[4-(1-methylpyrrolidine-2-carbonyl)piperazin-1-yl]-(prop-2-enylamino)methylidene]amino]acetamide (PubChem CID 110048000) has the molecular formula C18H32N6O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[4-(1-methylpyrrolidine-2-carbonyl)piperazin-1-yl]-(prop-2-enylamino)methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[[4-(1-methylpyrrolidine-2-carbonyl)piperazin-1-yl]-(prop-2-enylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110048000 |
| Molecular Formula | C18H32N6O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | N,N-dimethyl-2-[[[4-(1-methylpyrrolidine-2-carbonyl)piperazin-1-yl]-(prop-2-enylamino)methylidene]amino]acetamide |
| SMILES | C=CCN/C(=N\CC(=O)N(C)C)N1CCN(C(=O)C2CCCN2C)CC1 |
| InChI | InChI=1S/C18H32N6O2/c1-5-8-19-18(20-14-16(25)21(2)3)24-12-10-23(11-13-24)17(26)15-7-6-9-22(15)4/h5,15H,1,6-14H2,2-4H3,(H,19,20) |
| InChIKey | RHFIXFUKBMBONQ-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 71.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|