C24H37IN4O3 — CID 110049519
2-[[[4-(4-ethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]-(oxan-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110049519) has the molecular formula C24H37IN4O3 and a molecular weight of 556.49 g/mol. Its IUPAC name is 2-[[[4-(4-ethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]-(oxan-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[4-(4-ethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]-(oxan-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110049519 |
| Molecular Formula | C24H37IN4O3 |
| Molecular Weight | 556.49 g/mol |
| Exact Mass | 556.19 |
| IUPAC Name | 2-[[[4-(4-ethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]-(oxan-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCOc1ccc(C2=CCN(/C(=N/CC(=O)N(C)C)NCC3CCCCO3)CC2)cc1.I |
| InChI | InChI=1S/C24H36N4O3.HI/c1-4-30-21-10-8-19(9-11-21)20-12-14-28(15-13-20)24(26-18-23(29)27(2)3)25-17-22-7-5-6-16-31-22;/h8-12,22H,4-7,13-18H2,1-3H3,(H,25,26);1H |
| InChIKey | RKCHVEXQDJOGCI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|