C20H47FO3Si4 — CID 11005137
3-[fluoro-bis(trimethylsilyl)silyl]oxy-5-tri(propan-2-yl)silyloxypentanal (PubChem CID 11005137) has the molecular formula C20H47FO3Si4 and a molecular weight of 466.94 g/mol. Its IUPAC name is 3-[fluoro-bis(trimethylsilyl)silyl]oxy-5-tri(propan-2-yl)silyloxypentanal.
| Compound Name | 3-[fluoro-bis(trimethylsilyl)silyl]oxy-5-tri(propan-2-yl)silyloxypentanal |
|---|---|
| PubChem CID | 11005137 |
| Molecular Formula | C20H47FO3Si4 |
| Molecular Weight | 466.94 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | 3-[fluoro-bis(trimethylsilyl)silyl]oxy-5-tri(propan-2-yl)silyloxypentanal |
| SMILES | CC(C)[Si](OCCC(CC=O)O[Si](F)([Si](C)(C)C)[Si](C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H47FO3Si4/c1-17(2)27(18(3)4,19(5)6)23-16-14-20(13-15-22)24-28(21,25(7,8)9)26(10,11)12/h15,17-20H,13-14,16H2,1-12H3 |
| InChIKey | OKADSMGLDIKRCF-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.94 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|