C14H34O4Si3 — CID 91750433
(3R,4S)-3,4,5-tris(trimethylsilyloxy)pentanal (PubChem CID 91750433) has the molecular formula C14H34O4Si3 and a molecular weight of 350.68 g/mol. Its IUPAC name is (3R,4S)-3,4,5-tris(trimethylsilyloxy)pentanal.
| Compound Name | (3R,4S)-3,4,5-tris(trimethylsilyloxy)pentanal |
|---|---|
| PubChem CID | 91750433 |
| Molecular Formula | C14H34O4Si3 |
| Molecular Weight | 350.68 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | (3R,4S)-3,4,5-tris(trimethylsilyloxy)pentanal |
| SMILES | C[Si](C)(C)OC[C@H](O[Si](C)(C)C)[C@@H](CC=O)O[Si](C)(C)C |
| InChI | InChI=1S/C14H34O4Si3/c1-19(2,3)16-12-14(18-21(7,8)9)13(10-11-15)17-20(4,5)6/h11,13-14H,10,12H2,1-9H3/t13-,14+/m1/s1 |
| InChIKey | WJEJOIVWMARKGR-KGLIPLIRSA-N |
| XLogP | 3.87 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.68 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|