C13H32O4Si3 — CID 91750474
(2S,3S)-2,3,4-tris(trimethylsilyloxy)butanal (PubChem CID 91750474) has the molecular formula C13H32O4Si3 and a molecular weight of 336.65 g/mol. Its IUPAC name is (2S,3S)-2,3,4-tris(trimethylsilyloxy)butanal.
| Compound Name | (2S,3S)-2,3,4-tris(trimethylsilyloxy)butanal |
|---|---|
| PubChem CID | 91750474 |
| Molecular Formula | C13H32O4Si3 |
| Molecular Weight | 336.65 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | (2S,3S)-2,3,4-tris(trimethylsilyloxy)butanal |
| SMILES | C[Si](C)(C)OC[C@H](O[Si](C)(C)C)[C@@H](C=O)O[Si](C)(C)C |
| InChI | InChI=1S/C13H32O4Si3/c1-18(2,3)15-11-13(17-20(7,8)9)12(10-14)16-19(4,5)6/h10,12-13H,11H2,1-9H3/t12-,13+/m1/s1 |
| InChIKey | UPIKFSIKTWCYLN-OLZOCXBDSA-N |
| XLogP | 3.48 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.65 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|