C22H48O4Si2 — CID 11270435
(2S,3R)-3-hydroxy-2,4-bis[tri(propan-2-yl)silyloxy]butanal (PubChem CID 11270435) has the molecular formula C22H48O4Si2 and a molecular weight of 432.79 g/mol. Its IUPAC name is (2S,3R)-3-hydroxy-2,4-bis[tri(propan-2-yl)silyloxy]butanal.
| Compound Name | (2S,3R)-3-hydroxy-2,4-bis[tri(propan-2-yl)silyloxy]butanal |
|---|---|
| PubChem CID | 11270435 |
| Molecular Formula | C22H48O4Si2 |
| Molecular Weight | 432.79 g/mol |
| Exact Mass | 432.31 |
| IUPAC Name | (2S,3R)-3-hydroxy-2,4-bis[tri(propan-2-yl)silyloxy]butanal |
| SMILES | CC(C)[Si](OC[C@@H](O)[C@@H](C=O)O[Si](C(C)C)(C(C)C)C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H48O4Si2/c1-15(2)27(16(3)4,17(5)6)25-14-21(24)22(13-23)26-28(18(7)8,19(9)10)20(11)12/h13,15-22,24H,14H2,1-12H3/t21-,22-/m1/s1 |
| InChIKey | VWLZJMUTEROJON-FGZHOGPDSA-N |
| XLogP | 6.30 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.79 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|