C16H36O4Si2 — CID 135006937
(2S,3S)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxybutanal (PubChem CID 135006937) has the molecular formula C16H36O4Si2 and a molecular weight of 348.63 g/mol. Its IUPAC name is (2S,3S)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxybutanal.
| Compound Name | (2S,3S)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxybutanal |
|---|---|
| PubChem CID | 135006937 |
| Molecular Formula | C16H36O4Si2 |
| Molecular Weight | 348.63 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | (2S,3S)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxybutanal |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H](O)[C@@H](C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H36O4Si2/c1-15(2,3)21(7,8)19-12-13(18)14(11-17)20-22(9,10)16(4,5)6/h11,13-14,18H,12H2,1-10H3/t13-,14+/m0/s1 |
| InChIKey | XVARBXGGYXZZNN-UONOGXRCSA-N |
| XLogP | 3.96 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.63 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|