C23H28FN5O2 — CID 110052692
2-[[1-(4-fluorophenyl)pyrazol-3-yl]methyl]-1-[2-(furan-2-yl)ethyl]-3-(oxan-2-ylmethyl)guanidine (PubChem CID 110052692) has the molecular formula C23H28FN5O2 and a molecular weight of 425.51 g/mol. Its IUPAC name is 2-[[1-(4-fluorophenyl)pyrazol-3-yl]methyl]-1-[2-(furan-2-yl)ethyl]-3-(oxan-2-ylmethyl)guanidine.
| Compound Name | 2-[[1-(4-fluorophenyl)pyrazol-3-yl]methyl]-1-[2-(furan-2-yl)ethyl]-3-(oxan-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 110052692 |
| Molecular Formula | C23H28FN5O2 |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 2-[[1-(4-fluorophenyl)pyrazol-3-yl]methyl]-1-[2-(furan-2-yl)ethyl]-3-(oxan-2-ylmethyl)guanidine |
| SMILES | Fc1ccc(-n2ccc(C/N=C(\NCCc3ccco3)NCC3CCCCO3)n2)cc1 |
| InChI | InChI=1S/C23H28FN5O2/c24-18-6-8-20(9-7-18)29-13-11-19(28-29)16-26-23(25-12-10-21-5-3-15-30-21)27-17-22-4-1-2-14-31-22/h3,5-9,11,13,15,22H,1-2,4,10,12,14,16-17H2,(H2,25,26,27) |
| InChIKey | UXWRGYBYTRGABL-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 76.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|