C19H24N4O — CID 110052964
1-ethyl-2-[2-(furan-2-yl)ethyl]-3-[2-(1H-indol-2-yl)ethyl]guanidine (PubChem CID 110052964) has the molecular formula C19H24N4O and a molecular weight of 324.43 g/mol. Its IUPAC name is 1-ethyl-2-[2-(furan-2-yl)ethyl]-3-[2-(1H-indol-2-yl)ethyl]guanidine.
| Compound Name | 1-ethyl-2-[2-(furan-2-yl)ethyl]-3-[2-(1H-indol-2-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 110052964 |
| Molecular Formula | C19H24N4O |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 1-ethyl-2-[2-(furan-2-yl)ethyl]-3-[2-(1H-indol-2-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CCc1ccco1)NCCc1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H24N4O/c1-2-20-19(22-12-10-17-7-5-13-24-17)21-11-9-16-14-15-6-3-4-8-18(15)23-16/h3-8,13-14,23H,2,9-12H2,1H3,(H2,20,21,22) |
| InChIKey | CUAVXDZHWUAFHA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 65.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|