C26H28N4O2 — CID 110051232
1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-(furan-2-yl)ethyl]-3-[2-(1H-indol-2-yl)ethyl]guanidine (PubChem CID 110051232) has the molecular formula C26H28N4O2 and a molecular weight of 428.54 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-(furan-2-yl)ethyl]-3-[2-(1H-indol-2-yl)ethyl]guanidine.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-(furan-2-yl)ethyl]-3-[2-(1H-indol-2-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 110051232 |
| Molecular Formula | C26H28N4O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-(furan-2-yl)ethyl]-3-[2-(1H-indol-2-yl)ethyl]guanidine |
| SMILES | c1coc(CC/N=C(\NCCc2cc3ccccc3[nH]2)NC2CCOc3ccccc32)c1 |
| InChI | InChI=1S/C26H28N4O2/c1-3-9-23-19(6-1)18-20(29-23)11-14-27-26(28-15-12-21-7-5-16-31-21)30-24-13-17-32-25-10-4-2-8-22(24)25/h1-10,16,18,24,29H,11-15,17H2,(H2,27,28,30) |
| InChIKey | NWIVFBAHZOFTPA-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|