C20H28ClIN4O — CID 110054053
1-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-3-[2-(furan-2-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 110054053) has the molecular formula C20H28ClIN4O and a molecular weight of 502.83 g/mol. Its IUPAC name is 1-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-3-[2-(furan-2-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-3-[2-(furan-2-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110054053 |
| Molecular Formula | C20H28ClIN4O |
| Molecular Weight | 502.83 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | 1-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-3-[2-(furan-2-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccco1)NC1CCN(Cc2ccc(Cl)cc2)CC1.I |
| InChI | InChI=1S/C20H27ClN4O.HI/c1-22-20(23-11-8-19-3-2-14-26-19)24-18-9-12-25(13-10-18)15-16-4-6-17(21)7-5-16;/h2-7,14,18H,8-13,15H2,1H3,(H2,22,23,24);1H |
| InChIKey | ZGTDKRHQYHJNMK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 52.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.83 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|