C20H27N3O — CID 110054544
1-[2-(furan-2-yl)ethyl]-2-methyl-3-(4-phenylcyclohexyl)guanidine (PubChem CID 110054544) has the molecular formula C20H27N3O and a molecular weight of 325.46 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-2-methyl-3-(4-phenylcyclohexyl)guanidine.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-2-methyl-3-(4-phenylcyclohexyl)guanidine |
|---|---|
| PubChem CID | 110054544 |
| Molecular Formula | C20H27N3O |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-2-methyl-3-(4-phenylcyclohexyl)guanidine |
| SMILES | C/N=C(\NCCc1ccco1)NC1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H27N3O/c1-21-20(22-14-13-19-8-5-15-24-19)23-18-11-9-17(10-12-18)16-6-3-2-4-7-16/h2-8,15,17-18H,9-14H2,1H3,(H2,21,22,23) |
| InChIKey | TVKHHUFGGYFRFZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|