C17H21ClIN3O — CID 111775567
1-[2-(3-chlorophenyl)cyclopropyl]-3-[2-(furan-2-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111775567) has the molecular formula C17H21ClIN3O and a molecular weight of 445.73 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)cyclopropyl]-3-[2-(furan-2-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(3-chlorophenyl)cyclopropyl]-3-[2-(furan-2-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111775567 |
| Molecular Formula | C17H21ClIN3O |
| Molecular Weight | 445.73 g/mol |
| Exact Mass | 445.04 |
| IUPAC Name | 1-[2-(3-chlorophenyl)cyclopropyl]-3-[2-(furan-2-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccco1)NC1CC1c1cccc(Cl)c1.I |
| InChI | InChI=1S/C17H20ClN3O.HI/c1-19-17(20-8-7-14-6-3-9-22-14)21-16-11-15(16)12-4-2-5-13(18)10-12;/h2-6,9-10,15-16H,7-8,11H2,1H3,(H2,19,20,21);1H |
| InChIKey | WLCCEWJMQFCCHW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.73 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|