C17H20ClN3S — CID 111775476
1-[2-(3-chlorophenyl)cyclopropyl]-2-methyl-3-(2-thiophen-2-ylethyl)guanidine (PubChem CID 111775476) has the molecular formula C17H20ClN3S and a molecular weight of 333.89 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)cyclopropyl]-2-methyl-3-(2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-[2-(3-chlorophenyl)cyclopropyl]-2-methyl-3-(2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111775476 |
| Molecular Formula | C17H20ClN3S |
| Molecular Weight | 333.89 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 1-[2-(3-chlorophenyl)cyclopropyl]-2-methyl-3-(2-thiophen-2-ylethyl)guanidine |
| SMILES | C/N=C(\NCCc1cccs1)NC1CC1c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H20ClN3S/c1-19-17(20-8-7-14-6-3-9-22-14)21-16-11-15(16)12-4-2-5-13(18)10-12/h2-6,9-10,15-16H,7-8,11H2,1H3,(H2,19,20,21) |
| InChIKey | OMYWOKYYRRTRHT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.89 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|