C24H33N7O — CID 110057286
1-[2-(furan-2-yl)ethyl]-2-[3-(N-methylanilino)propyl]-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)guanidine (PubChem CID 110057286) has the molecular formula C24H33N7O and a molecular weight of 435.58 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-2-[3-(N-methylanilino)propyl]-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)guanidine.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-2-[3-(N-methylanilino)propyl]-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)guanidine |
|---|---|
| PubChem CID | 110057286 |
| Molecular Formula | C24H33N7O |
| Molecular Weight | 435.58 g/mol |
| Exact Mass | 435.27 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-2-[3-(N-methylanilino)propyl]-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)guanidine |
| SMILES | Cc1nc2n(n1)CCCC2N/C(=N/CCCN(C)c1ccccc1)NCCc1ccco1 |
| InChI | InChI=1S/C24H33N7O/c1-19-27-23-22(12-6-17-31(23)29-19)28-24(26-15-13-21-11-7-18-32-21)25-14-8-16-30(2)20-9-4-3-5-10-20/h3-5,7,9-11,18,22H,6,8,12-17H2,1-2H3,(H2,25,26,28) |
| InChIKey | VMJYEYJSVBZPDY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 83.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.58 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|