C19H27N3O3 — CID 110058334
2-butyl-1-(3,4-dimethoxyphenyl)-3-[2-(furan-2-yl)ethyl]guanidine (PubChem CID 110058334) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is 2-butyl-1-(3,4-dimethoxyphenyl)-3-[2-(furan-2-yl)ethyl]guanidine.
| Compound Name | 2-butyl-1-(3,4-dimethoxyphenyl)-3-[2-(furan-2-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 110058334 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 2-butyl-1-(3,4-dimethoxyphenyl)-3-[2-(furan-2-yl)ethyl]guanidine |
| SMILES | CCCC/N=C(\NCCc1ccco1)Nc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C19H27N3O3/c1-4-5-11-20-19(21-12-10-16-7-6-13-25-16)22-15-8-9-17(23-2)18(14-15)24-3/h6-9,13-14H,4-5,10-12H2,1-3H3,(H2,20,21,22) |
| InChIKey | NCDXAIYVKWLNMF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|