C22H31IN4O3 — CID 110058549
2-butyl-1-[2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethyl]-3-[2-(furan-2-yl)ethyl]guanidine;hydroiodide (PubChem CID 110058549) has the molecular formula C22H31IN4O3 and a molecular weight of 526.42 g/mol. Its IUPAC name is 2-butyl-1-[2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethyl]-3-[2-(furan-2-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-butyl-1-[2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethyl]-3-[2-(furan-2-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110058549 |
| Molecular Formula | C22H31IN4O3 |
| Molecular Weight | 526.42 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | 2-butyl-1-[2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethyl]-3-[2-(furan-2-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCCC/N=C(\NCCc1ccco1)NCCN1C(=O)C2C3C=CC(C3)C2C1=O.I |
| InChI | InChI=1S/C22H30N4O3.HI/c1-2-3-9-23-22(24-10-8-17-5-4-13-29-17)25-11-12-26-20(27)18-15-6-7-16(14-15)19(18)21(26)28;/h4-7,13,15-16,18-19H,2-3,8-12,14H2,1H3,(H2,23,24,25);1H |
| InChIKey | VYRZCQCWUORZNV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|