C21H29IN4O3S — CID 110058557
1-[2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethyl]-3-[2-(furan-2-yl)ethyl]-2-(2-methylsulfanylethyl)guanidine;hydroiodide (PubChem CID 110058557) has the molecular formula C21H29IN4O3S and a molecular weight of 544.46 g/mol. Its IUPAC name is 1-[2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethyl]-3-[2-(furan-2-yl)ethyl]-2-(2-methylsulfanylethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethyl]-3-[2-(furan-2-yl)ethyl]-2-(2-methylsulfanylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110058557 |
| Molecular Formula | C21H29IN4O3S |
| Molecular Weight | 544.46 g/mol |
| Exact Mass | 544.10 |
| IUPAC Name | 1-[2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethyl]-3-[2-(furan-2-yl)ethyl]-2-(2-methylsulfanylethyl)guanidine;hydroiodide |
| SMILES | CSCC/N=C(\NCCc1ccco1)NCCN1C(=O)C2C3C=CC(C3)C2C1=O.I |
| InChI | InChI=1S/C21H28N4O3S.HI/c1-29-12-9-24-21(22-7-6-16-3-2-11-28-16)23-8-10-25-19(26)17-14-4-5-15(13-14)18(17)20(25)27;/h2-5,11,14-15,17-18H,6-10,12-13H2,1H3,(H2,22,23,24);1H |
| InChIKey | AOMMIBDAMJZOOC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.46 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|