C11H18N3O13P3S — CID 11005896
[hydroxy-[[(2R,3S,5R)-3-hydroxy-5-(7-oxo-3,4-dihydro-1H-pyrimido[4,5-c]oxazin-6-yl)oxolan-2-yl]methoxy]phosphinothioyl] phosphono hydrogen phosphate (PubChem CID 11005896) has the molecular formula C11H18N3O13P3S and a molecular weight of 525.26 g/mol. Its IUPAC name is [hydroxy-[[(2R,3S,5R)-3-hydroxy-5-(7-oxo-3,4-dihydro-1H-pyrimido[4,5-c]oxazin-6-yl)oxolan-2-yl]methoxy]phosphinothioyl] phosphono hydrogen phosphate.
| Compound Name | [hydroxy-[[(2R,3S,5R)-3-hydroxy-5-(7-oxo-3,4-dihydro-1H-pyrimido[4,5-c]oxazin-6-yl)oxolan-2-yl]methoxy]phosphinothioyl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 11005896 |
| Molecular Formula | C11H18N3O13P3S |
| Molecular Weight | 525.26 g/mol |
| Exact Mass | 524.98 |
| IUPAC Name | [hydroxy-[[(2R,3S,5R)-3-hydroxy-5-(7-oxo-3,4-dihydro-1H-pyrimido[4,5-c]oxazin-6-yl)oxolan-2-yl]methoxy]phosphinothioyl] phosphono hydrogen phosphate |
| SMILES | O=c1nc2c(cn1[C@H]1C[C@H](O)[C@@H](COP(O)(=S)OP(=O)(O)OP(=O)(O)O)O1)CCON2 |
| InChI | InChI=1S/C11H18N3O13P3S/c15-7-3-9(14-4-6-1-2-23-13-10(6)12-11(14)16)25-8(7)5-24-30(22,31)27-29(20,21)26-28(17,18)19/h4,7-9,15H,1-3,5H2,(H,20,21)(H,22,31)(H,12,13,16)(H2,17,18,19)/t7-,8+,9+,30?/m0/s1 |
| InChIKey | GPBFGCNUVSBOSM-ZQIZWCHISA-N |
| XLogP | -0.75 |
| TPSA | 228.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.26 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|