C22H33IN4O4S — CID 110059119
ethyl 2-[1-[[N-[2-(furan-2-yl)ethyl]-N'-(oxan-2-ylmethyl)carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxylate;hydroiodide (PubChem CID 110059119) has the molecular formula C22H33IN4O4S and a molecular weight of 576.50 g/mol. Its IUPAC name is ethyl 2-[1-[[N-[2-(furan-2-yl)ethyl]-N'-(oxan-2-ylmethyl)carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxylate;hydroiodide.
| Compound Name | ethyl 2-[1-[[N-[2-(furan-2-yl)ethyl]-N'-(oxan-2-ylmethyl)carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 110059119 |
| Molecular Formula | C22H33IN4O4S |
| Molecular Weight | 576.50 g/mol |
| Exact Mass | 576.13 |
| IUPAC Name | ethyl 2-[1-[[N-[2-(furan-2-yl)ethyl]-N'-(oxan-2-ylmethyl)carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxylate;hydroiodide |
| SMILES | CCOC(=O)c1sc(C(C)N/C(=N/CC2CCCCO2)NCCc2ccco2)nc1C.I |
| InChI | InChI=1S/C22H32N4O4S.HI/c1-4-28-21(27)19-15(2)25-20(31-19)16(3)26-22(23-11-10-17-9-7-13-29-17)24-14-18-8-5-6-12-30-18;/h7,9,13,16,18H,4-6,8,10-12,14H2,1-3H3,(H2,23,24,26);1H |
| InChIKey | RUQAWSCZQGCDQI-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|