C20H34IN5O4S — CID 110046244
ethyl 2-[1-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(oxan-2-ylmethyl)carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxylate;hydroiodide (PubChem CID 110046244) has the molecular formula C20H34IN5O4S and a molecular weight of 567.49 g/mol. Its IUPAC name is ethyl 2-[1-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(oxan-2-ylmethyl)carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxylate;hydroiodide.
| Compound Name | ethyl 2-[1-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(oxan-2-ylmethyl)carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 110046244 |
| Molecular Formula | C20H34IN5O4S |
| Molecular Weight | 567.49 g/mol |
| Exact Mass | 567.14 |
| IUPAC Name | ethyl 2-[1-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(oxan-2-ylmethyl)carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxylate;hydroiodide |
| SMILES | CCOC(=O)c1sc(C(C)N/C(=N\CC(=O)N(C)C)NCC2CCCCO2)nc1C.I |
| InChI | InChI=1S/C20H33N5O4S.HI/c1-6-28-19(27)17-13(2)23-18(30-17)14(3)24-20(22-12-16(26)25(4)5)21-11-15-9-7-8-10-29-15;/h14-15H,6-12H2,1-5H3,(H2,21,22,24);1H |
| InChIKey | LAWMLFCYUCODSW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.49 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|