C19H33IN4O4S — CID 110059193
N-[2-(furan-2-yl)ethyl]-2,2-dimethyl-N'-(2-morpholin-4-ylethyl)-1,1-dioxo-1,4-thiazinane-4-carboximidamide;hydroiodide (PubChem CID 110059193) has the molecular formula C19H33IN4O4S and a molecular weight of 540.47 g/mol. Its IUPAC name is N-[2-(furan-2-yl)ethyl]-2,2-dimethyl-N'-(2-morpholin-4-ylethyl)-1,1-dioxo-1,4-thiazinane-4-carboximidamide;hydroiodide.
| Compound Name | N-[2-(furan-2-yl)ethyl]-2,2-dimethyl-N'-(2-morpholin-4-ylethyl)-1,1-dioxo-1,4-thiazinane-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110059193 |
| Molecular Formula | C19H33IN4O4S |
| Molecular Weight | 540.47 g/mol |
| Exact Mass | 540.13 |
| IUPAC Name | N-[2-(furan-2-yl)ethyl]-2,2-dimethyl-N'-(2-morpholin-4-ylethyl)-1,1-dioxo-1,4-thiazinane-4-carboximidamide;hydroiodide |
| SMILES | CC1(C)CN(/C(=N/CCN2CCOCC2)NCCc2ccco2)CCS1(=O)=O.I |
| InChI | InChI=1S/C19H32N4O4S.HI/c1-19(2)16-23(11-15-28(19,24)25)18(20-6-5-17-4-3-12-27-17)21-7-8-22-9-13-26-14-10-22;/h3-4,12H,5-11,13-16H2,1-2H3,(H,20,21);1H |
| InChIKey | ZFTAHYNQDHZTKK-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.47 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|