C16H28IN3OS2 — CID 110059421
1-[2-(furan-2-yl)ethyl]-3-(2-methylsulfanylethyl)-2-[(2-methylthiolan-2-yl)methyl]guanidine;hydroiodide (PubChem CID 110059421) has the molecular formula C16H28IN3OS2 and a molecular weight of 469.46 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-3-(2-methylsulfanylethyl)-2-[(2-methylthiolan-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-3-(2-methylsulfanylethyl)-2-[(2-methylthiolan-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110059421 |
| Molecular Formula | C16H28IN3OS2 |
| Molecular Weight | 469.46 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-3-(2-methylsulfanylethyl)-2-[(2-methylthiolan-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CSCCN/C(=N\CC1(C)CCCS1)NCCc1ccco1.I |
| InChI | InChI=1S/C16H27N3OS2.HI/c1-16(7-4-11-22-16)13-19-15(18-9-12-21-2)17-8-6-14-5-3-10-20-14;/h3,5,10H,4,6-9,11-13H2,1-2H3,(H2,17,18,19);1H |
| InChIKey | UBCZGCBQJYKJOJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|