C22H33N5O2 — CID 110059638
N-[2-(furan-2-yl)ethyl]-3-imidazol-1-yl-4-methyl-N'-(oxan-2-ylmethyl)piperidine-1-carboximidamide (PubChem CID 110059638) has the molecular formula C22H33N5O2 and a molecular weight of 399.54 g/mol. Its IUPAC name is N-[2-(furan-2-yl)ethyl]-3-imidazol-1-yl-4-methyl-N'-(oxan-2-ylmethyl)piperidine-1-carboximidamide.
| Compound Name | N-[2-(furan-2-yl)ethyl]-3-imidazol-1-yl-4-methyl-N'-(oxan-2-ylmethyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 110059638 |
| Molecular Formula | C22H33N5O2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | N-[2-(furan-2-yl)ethyl]-3-imidazol-1-yl-4-methyl-N'-(oxan-2-ylmethyl)piperidine-1-carboximidamide |
| SMILES | CC1CCN(/C(=N/CC2CCCCO2)NCCc2ccco2)CC1n1ccnc1 |
| InChI | InChI=1S/C22H33N5O2/c1-18-8-11-26(16-21(18)27-12-10-23-17-27)22(24-9-7-19-6-4-14-28-19)25-15-20-5-2-3-13-29-20/h4,6,10,12,14,17-18,20-21H,2-3,5,7-9,11,13,15-16H2,1H3,(H,24,25) |
| InChIKey | UVXPUIAVIKVACJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 67.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|