C24H36N4O3 — CID 110059846
1-[2-(furan-2-yl)ethyl]-2-[[3-(2-hydroxyethyl)oxolan-3-yl]methyl]-3-[3-(N-methylanilino)propyl]guanidine (PubChem CID 110059846) has the molecular formula C24H36N4O3 and a molecular weight of 428.58 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-2-[[3-(2-hydroxyethyl)oxolan-3-yl]methyl]-3-[3-(N-methylanilino)propyl]guanidine.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-2-[[3-(2-hydroxyethyl)oxolan-3-yl]methyl]-3-[3-(N-methylanilino)propyl]guanidine |
|---|---|
| PubChem CID | 110059846 |
| Molecular Formula | C24H36N4O3 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-2-[[3-(2-hydroxyethyl)oxolan-3-yl]methyl]-3-[3-(N-methylanilino)propyl]guanidine |
| SMILES | CN(CCCN/C(=N/CC1(CCO)CCOC1)NCCc1ccco1)c1ccccc1 |
| InChI | InChI=1S/C24H36N4O3/c1-28(21-7-3-2-4-8-21)15-6-13-25-23(26-14-10-22-9-5-17-31-22)27-19-24(11-16-29)12-18-30-20-24/h2-5,7-9,17,29H,6,10-16,18-20H2,1H3,(H2,25,26,27) |
| InChIKey | KDSSYWOINOYJBJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|