C20H39IO5Si2 — CID 11006064
methyl (5R)-5-[(2R,3aR,4S,5R,6aS)-5-trimethylsilyloxy-4-(trimethylsilyloxymethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-iodopentanoate (PubChem CID 11006064) has the molecular formula C20H39IO5Si2 and a molecular weight of 542.60 g/mol. Its IUPAC name is methyl (5R)-5-[(2R,3aR,4S,5R,6aS)-5-trimethylsilyloxy-4-(trimethylsilyloxymethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-iodopentanoate.
| Compound Name | methyl (5R)-5-[(2R,3aR,4S,5R,6aS)-5-trimethylsilyloxy-4-(trimethylsilyloxymethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-iodopentanoate |
|---|---|
| PubChem CID | 11006064 |
| Molecular Formula | C20H39IO5Si2 |
| Molecular Weight | 542.60 g/mol |
| Exact Mass | 542.14 |
| IUPAC Name | methyl (5R)-5-[(2R,3aR,4S,5R,6aS)-5-trimethylsilyloxy-4-(trimethylsilyloxymethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-iodopentanoate |
| SMILES | COC(=O)CCC[C@@H](I)[C@H]1C[C@@H]2[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)C[C@@H]2O1 |
| InChI | InChI=1S/C20H39IO5Si2/c1-23-20(22)10-8-9-16(21)19-11-14-15(13-24-27(2,3)4)18(12-17(14)25-19)26-28(5,6)7/h14-19H,8-13H2,1-7H3/t14-,15-,16-,17+,18-,19-/m1/s1 |
| InChIKey | NSNZEQUCVABNDI-WVXCVLBUSA-N |
| XLogP | 5.00 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.60 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|