C24H33IN4O3 — CID 110061585
2-[(1-cyclopropyl-5-oxopyrrolidin-3-yl)methyl]-1-[2-(furan-2-yl)ethyl]-3-[2-(4-methoxyphenyl)ethyl]guanidine;hydroiodide (PubChem CID 110061585) has the molecular formula C24H33IN4O3 and a molecular weight of 552.46 g/mol. Its IUPAC name is 2-[(1-cyclopropyl-5-oxopyrrolidin-3-yl)methyl]-1-[2-(furan-2-yl)ethyl]-3-[2-(4-methoxyphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[(1-cyclopropyl-5-oxopyrrolidin-3-yl)methyl]-1-[2-(furan-2-yl)ethyl]-3-[2-(4-methoxyphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110061585 |
| Molecular Formula | C24H33IN4O3 |
| Molecular Weight | 552.46 g/mol |
| Exact Mass | 552.16 |
| IUPAC Name | 2-[(1-cyclopropyl-5-oxopyrrolidin-3-yl)methyl]-1-[2-(furan-2-yl)ethyl]-3-[2-(4-methoxyphenyl)ethyl]guanidine;hydroiodide |
| SMILES | COc1ccc(CCN/C(=N/CC2CC(=O)N(C3CC3)C2)NCCc2ccco2)cc1.I |
| InChI | InChI=1S/C24H32N4O3.HI/c1-30-21-8-4-18(5-9-21)10-12-25-24(26-13-11-22-3-2-14-31-22)27-16-19-15-23(29)28(17-19)20-6-7-20;/h2-5,8-9,14,19-20H,6-7,10-13,15-17H2,1H3,(H2,25,26,27);1H |
| InChIKey | UJXZVPSZEXMZJR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|