C22H32N4O4S — CID 110050520
1-[2-(furan-2-yl)ethyl]-3-[2-(4-methoxyphenyl)ethyl]-2-[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methyl]guanidine (PubChem CID 110050520) has the molecular formula C22H32N4O4S and a molecular weight of 448.59 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-3-[2-(4-methoxyphenyl)ethyl]-2-[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methyl]guanidine.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-3-[2-(4-methoxyphenyl)ethyl]-2-[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 110050520 |
| Molecular Formula | C22H32N4O4S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-3-[2-(4-methoxyphenyl)ethyl]-2-[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methyl]guanidine |
| SMILES | COc1ccc(CCN/C(=N/C[C@H]2CCCN2S(C)(=O)=O)NCCc2ccco2)cc1 |
| InChI | InChI=1S/C22H32N4O4S/c1-29-20-9-7-18(8-10-20)11-13-23-22(24-14-12-21-6-4-16-30-21)25-17-19-5-3-15-26(19)31(2,27)28/h4,6-10,16,19H,3,5,11-15,17H2,1-2H3,(H2,23,24,25)/t19-/m1/s1 |
| InChIKey | ISMODBWLCKPXMJ-LJQANCHMSA-N |
| XLogP | 2.03 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|