C39H34O6 — CID 11006500
(2R,4S)-2-phenyl-4-[(2S,4R,5S)-2-phenyl-5-(trityloxymethyl)-1,3-dioxolan-4-yl]-1,3-dioxan-5-one (PubChem CID 11006500) has the molecular formula C39H34O6 and a molecular weight of 598.70 g/mol. Its IUPAC name is (2R,4S)-2-phenyl-4-[(2S,4R,5S)-2-phenyl-5-(trityloxymethyl)-1,3-dioxolan-4-yl]-1,3-dioxan-5-one.
| Compound Name | (2R,4S)-2-phenyl-4-[(2S,4R,5S)-2-phenyl-5-(trityloxymethyl)-1,3-dioxolan-4-yl]-1,3-dioxan-5-one |
|---|---|
| PubChem CID | 11006500 |
| Molecular Formula | C39H34O6 |
| Molecular Weight | 598.70 g/mol |
| Exact Mass | 598.24 |
| IUPAC Name | (2R,4S)-2-phenyl-4-[(2S,4R,5S)-2-phenyl-5-(trityloxymethyl)-1,3-dioxolan-4-yl]-1,3-dioxan-5-one |
| SMILES | O=C1CO[C@@H](c2ccccc2)O[C@H]1[C@@H]1O[C@@H](c2ccccc2)O[C@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H34O6/c40-33-26-41-37(28-16-6-1-7-17-28)44-35(33)36-34(43-38(45-36)29-18-8-2-9-19-29)27-42-39(30-20-10-3-11-21-30,31-22-12-4-13-23-31)32-24-14-5-15-25-32/h1-25,34-38H,26-27H2/t34-,35+,36+,37+,38-/m0/s1 |
| InChIKey | MESSZRNJJVUFAQ-QZFGVDEJSA-N |
| XLogP | 7.16 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.70 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|