C23H32N4O4 — CID 110065852
1-[(7S)-17-ethoxy-12,15-dioxa-3,9-diazatricyclo[14.4.0.03,7]icosa-1(16),17,19-trien-9-yl]-2-imidazol-1-ylethanone (PubChem CID 110065852) has the molecular formula C23H32N4O4 and a molecular weight of 428.53 g/mol. Its IUPAC name is 1-[(7S)-17-ethoxy-12,15-dioxa-3,9-diazatricyclo[14.4.0.03,7]icosa-1(16),17,19-trien-9-yl]-2-imidazol-1-ylethanone.
| Compound Name | 1-[(7S)-17-ethoxy-12,15-dioxa-3,9-diazatricyclo[14.4.0.03,7]icosa-1(16),17,19-trien-9-yl]-2-imidazol-1-ylethanone |
|---|---|
| PubChem CID | 110065852 |
| Molecular Formula | C23H32N4O4 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | 1-[(7S)-17-ethoxy-12,15-dioxa-3,9-diazatricyclo[14.4.0.03,7]icosa-1(16),17,19-trien-9-yl]-2-imidazol-1-ylethanone |
| SMILES | CCOc1cccc2c1OCCOCCN(C(=O)Cn1ccnc1)C[C@@H]1CCCN1C2 |
| InChI | InChI=1S/C23H32N4O4/c1-2-30-21-7-3-5-19-15-26-9-4-6-20(26)16-27(11-12-29-13-14-31-23(19)21)22(28)17-25-10-8-24-18-25/h3,5,7-8,10,18,20H,2,4,6,9,11-17H2,1H3/t20-/m0/s1 |
| InChIKey | LVGYNUQWCWVCNS-FQEVSTJZSA-N |
| XLogP | 2.18 |
| TPSA | 69.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |