C31H41N3O6 — CID 110065851
1-[2-[2-[(7S)-17-ethoxy-12,15-dioxa-3,9-diazatricyclo[14.4.0.03,7]icosa-1(16),17,19-triene-9-carbonyl]phenoxy]ethyl]pyrrolidin-2-one (PubChem CID 110065851) has the molecular formula C31H41N3O6 and a molecular weight of 551.68 g/mol. Its IUPAC name is 1-[2-[2-[(7S)-17-ethoxy-12,15-dioxa-3,9-diazatricyclo[14.4.0.03,7]icosa-1(16),17,19-triene-9-carbonyl]phenoxy]ethyl]pyrrolidin-2-one.
| Compound Name | 1-[2-[2-[(7S)-17-ethoxy-12,15-dioxa-3,9-diazatricyclo[14.4.0.03,7]icosa-1(16),17,19-triene-9-carbonyl]phenoxy]ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 110065851 |
| Molecular Formula | C31H41N3O6 |
| Molecular Weight | 551.68 g/mol |
| Exact Mass | 551.30 |
| IUPAC Name | 1-[2-[2-[(7S)-17-ethoxy-12,15-dioxa-3,9-diazatricyclo[14.4.0.03,7]icosa-1(16),17,19-triene-9-carbonyl]phenoxy]ethyl]pyrrolidin-2-one |
| SMILES | CCOc1cccc2c1OCCOCCN(C(=O)c1ccccc1OCCN1CCCC1=O)C[C@@H]1CCCN1C2 |
| InChI | InChI=1S/C31H41N3O6/c1-2-38-28-12-5-8-24-22-33-15-6-9-25(33)23-34(16-18-37-20-21-40-30(24)28)31(36)26-10-3-4-11-27(26)39-19-17-32-14-7-13-29(32)35/h3-5,8,10-12,25H,2,6-7,9,13-23H2,1H3/t25-/m0/s1 |
| InChIKey | RMKWPKDASHIYPN-VWLOTQADSA-N |
| XLogP | 3.60 |
| TPSA | 80.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.68 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |