C24H34N4O4 — CID 110065869
1-[(7S)-17-ethoxy-12,15-dioxa-3,9-diazatricyclo[14.4.0.03,7]icosa-1(16),17,19-trien-9-yl]-2-(4-methylpyrazol-1-yl)ethanone (PubChem CID 110065869) has the molecular formula C24H34N4O4 and a molecular weight of 442.56 g/mol. Its IUPAC name is 1-[(7S)-17-ethoxy-12,15-dioxa-3,9-diazatricyclo[14.4.0.03,7]icosa-1(16),17,19-trien-9-yl]-2-(4-methylpyrazol-1-yl)ethanone.
| Compound Name | 1-[(7S)-17-ethoxy-12,15-dioxa-3,9-diazatricyclo[14.4.0.03,7]icosa-1(16),17,19-trien-9-yl]-2-(4-methylpyrazol-1-yl)ethanone |
|---|---|
| PubChem CID | 110065869 |
| Molecular Formula | C24H34N4O4 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | 1-[(7S)-17-ethoxy-12,15-dioxa-3,9-diazatricyclo[14.4.0.03,7]icosa-1(16),17,19-trien-9-yl]-2-(4-methylpyrazol-1-yl)ethanone |
| SMILES | CCOc1cccc2c1OCCOCCN(C(=O)Cn1cc(C)cn1)C[C@@H]1CCCN1C2 |
| InChI | InChI=1S/C24H34N4O4/c1-3-31-22-8-4-6-20-16-26-9-5-7-21(26)17-27(10-11-30-12-13-32-24(20)22)23(29)18-28-15-19(2)14-25-28/h4,6,8,14-15,21H,3,5,7,9-13,16-18H2,1-2H3/t21-/m0/s1 |
| InChIKey | CBZUMNMLGQFWQP-NRFANRHFSA-N |
| XLogP | 2.49 |
| TPSA | 69.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |