C30H33N5O3 — CID 110066639
13-[[1-[4-(dimethylamino)phenyl]pyrrol-2-yl]methyl]-10-methyl-2,16-dioxa-4,10,13-triazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-9-one (PubChem CID 110066639) has the molecular formula C30H33N5O3 and a molecular weight of 511.63 g/mol. Its IUPAC name is 13-[[1-[4-(dimethylamino)phenyl]pyrrol-2-yl]methyl]-10-methyl-2,16-dioxa-4,10,13-triazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-9-one.
| Compound Name | 13-[[1-[4-(dimethylamino)phenyl]pyrrol-2-yl]methyl]-10-methyl-2,16-dioxa-4,10,13-triazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-9-one |
|---|---|
| PubChem CID | 110066639 |
| Molecular Formula | C30H33N5O3 |
| Molecular Weight | 511.63 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | 13-[[1-[4-(dimethylamino)phenyl]pyrrol-2-yl]methyl]-10-methyl-2,16-dioxa-4,10,13-triazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-9-one |
| SMILES | CN1CCN(Cc2cccn2-c2ccc(N(C)C)cc2)CCOc2ccccc2Oc2ncccc2C1=O |
| InChI | InChI=1S/C30H33N5O3/c1-32(2)23-12-14-24(15-13-23)35-17-7-8-25(35)22-34-19-18-33(3)30(36)26-9-6-16-31-29(26)38-28-11-5-4-10-27(28)37-21-20-34/h4-17H,18-22H2,1-3H3 |
| InChIKey | GMLUBQWEOOYMKL-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 63.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.63 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|