C22H23N5O4S — CID 110065748
13-(4-ethylthiadiazole-5-carbonyl)-10-methyl-2,16-dioxa-4,10,13-triazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-9-one (PubChem CID 110065748) has the molecular formula C22H23N5O4S and a molecular weight of 453.52 g/mol. Its IUPAC name is 13-(4-ethylthiadiazole-5-carbonyl)-10-methyl-2,16-dioxa-4,10,13-triazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-9-one.
| Compound Name | 13-(4-ethylthiadiazole-5-carbonyl)-10-methyl-2,16-dioxa-4,10,13-triazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-9-one |
|---|---|
| PubChem CID | 110065748 |
| Molecular Formula | C22H23N5O4S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 13-(4-ethylthiadiazole-5-carbonyl)-10-methyl-2,16-dioxa-4,10,13-triazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-9-one |
| SMILES | CCc1nnsc1C(=O)N1CCOc2ccccc2Oc2ncccc2C(=O)N(C)CC1 |
| InChI | InChI=1S/C22H23N5O4S/c1-3-16-19(32-25-24-16)22(29)27-12-11-26(2)21(28)15-7-6-10-23-20(15)31-18-9-5-4-8-17(18)30-14-13-27/h4-10H,3,11-14H2,1-2H3 |
| InChIKey | FMSKKTAPENDQAL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 97.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |