C31H36N4O4 — CID 110070752
13-[2-(2-benzylpiperidin-1-yl)-2-oxoethyl]-10-methyl-2,16-dioxa-4,10,13-triazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-9-one (PubChem CID 110070752) has the molecular formula C31H36N4O4 and a molecular weight of 528.65 g/mol. Its IUPAC name is 13-[2-(2-benzylpiperidin-1-yl)-2-oxoethyl]-10-methyl-2,16-dioxa-4,10,13-triazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-9-one.
| Compound Name | 13-[2-(2-benzylpiperidin-1-yl)-2-oxoethyl]-10-methyl-2,16-dioxa-4,10,13-triazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-9-one |
|---|---|
| PubChem CID | 110070752 |
| Molecular Formula | C31H36N4O4 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | 13-[2-(2-benzylpiperidin-1-yl)-2-oxoethyl]-10-methyl-2,16-dioxa-4,10,13-triazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-9-one |
| SMILES | CN1CCN(CC(=O)N2CCCCC2Cc2ccccc2)CCOc2ccccc2Oc2ncccc2C1=O |
| InChI | InChI=1S/C31H36N4O4/c1-33-18-19-34(23-29(36)35-17-8-7-12-25(35)22-24-10-3-2-4-11-24)20-21-38-27-14-5-6-15-28(27)39-30-26(31(33)37)13-9-16-32-30/h2-6,9-11,13-16,25H,7-8,12,17-23H2,1H3 |
| InChIKey | GFXFVEAIFSSLKQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 75.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |