C27H35N3O6 — CID 110071570
2-[2-[4-(2,17-dioxa-4,10-diazatricyclo[16.4.0.03,8]docosa-1(22),3(8),4,6,18,20-hexaen-10-yl)piperidin-1-yl]-2-oxoethoxy]acetic acid (PubChem CID 110071570) has the molecular formula C27H35N3O6 and a molecular weight of 497.59 g/mol. Its IUPAC name is 2-[2-[4-(2,17-dioxa-4,10-diazatricyclo[16.4.0.03,8]docosa-1(22),3(8),4,6,18,20-hexaen-10-yl)piperidin-1-yl]-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-[4-(2,17-dioxa-4,10-diazatricyclo[16.4.0.03,8]docosa-1(22),3(8),4,6,18,20-hexaen-10-yl)piperidin-1-yl]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 110071570 |
| Molecular Formula | C27H35N3O6 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.25 |
| IUPAC Name | 2-[2-[4-(2,17-dioxa-4,10-diazatricyclo[16.4.0.03,8]docosa-1(22),3(8),4,6,18,20-hexaen-10-yl)piperidin-1-yl]-2-oxoethoxy]acetic acid |
| SMILES | O=C(O)COCC(=O)N1CCC(N2CCCCCCOc3ccccc3Oc3ncccc3C2)CC1 |
| InChI | InChI=1S/C27H35N3O6/c31-25(19-34-20-26(32)33)29-15-11-22(12-16-29)30-14-5-1-2-6-17-35-23-9-3-4-10-24(23)36-27-21(18-30)8-7-13-28-27/h3-4,7-10,13,22H,1-2,5-6,11-12,14-20H2,(H,32,33) |
| InChIKey | XCRSCTVPDGJHSV-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 101.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |