C27H30N2O5S — CID 110065363
4-(benzenesulfonyl)-1-(2,16-dioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-10-yl)butan-1-one (PubChem CID 110065363) has the molecular formula C27H30N2O5S and a molecular weight of 494.61 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-1-(2,16-dioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-10-yl)butan-1-one.
| Compound Name | 4-(benzenesulfonyl)-1-(2,16-dioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-10-yl)butan-1-one |
|---|---|
| PubChem CID | 110065363 |
| Molecular Formula | C27H30N2O5S |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | 4-(benzenesulfonyl)-1-(2,16-dioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-10-yl)butan-1-one |
| SMILES | O=C(CCCS(=O)(=O)c1ccccc1)N1CCCCCOc2ccccc2Oc2ncccc2C1 |
| InChI | InChI=1S/C27H30N2O5S/c30-26(16-10-20-35(31,32)23-12-3-1-4-13-23)29-18-7-2-8-19-33-24-14-5-6-15-25(24)34-27-22(21-29)11-9-17-28-27/h1,3-6,9,11-15,17H,2,7-8,10,16,18-21H2 |
| InChIKey | RWCDBJFIPXSNDI-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |