C29H32N4O3 — CID 133066097
5-(1H-benzimidazol-2-yl)-1-(2,16-dioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-10-yl)pentan-1-one (PubChem CID 133066097) has the molecular formula C29H32N4O3 and a molecular weight of 484.60 g/mol. Its IUPAC name is 5-(1H-benzimidazol-2-yl)-1-(2,16-dioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-10-yl)pentan-1-one.
| Compound Name | 5-(1H-benzimidazol-2-yl)-1-(2,16-dioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-10-yl)pentan-1-one |
|---|---|
| PubChem CID | 133066097 |
| Molecular Formula | C29H32N4O3 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | 5-(1H-benzimidazol-2-yl)-1-(2,16-dioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-10-yl)pentan-1-one |
| SMILES | O=C(CCCCc1nc2ccccc2[nH]1)N1CCCCCOc2ccccc2Oc2ncccc2C1 |
| InChI | InChI=1S/C29H32N4O3/c34-28(17-7-6-16-27-31-23-12-2-3-13-24(23)32-27)33-19-8-1-9-20-35-25-14-4-5-15-26(25)36-29-22(21-33)11-10-18-30-29/h2-5,10-15,18H,1,6-9,16-17,19-21H2,(H,31,32) |
| InChIKey | KDCVDJKJEZKMQT-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|