C31H36FN3O3 — CID 110071973
[4-(14,14-dimethyl-2,16-dioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-10-yl)piperidin-1-yl]-(3-fluorophenyl)methanone (PubChem CID 110071973) has the molecular formula C31H36FN3O3 and a molecular weight of 517.65 g/mol. Its IUPAC name is [4-(14,14-dimethyl-2,16-dioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-10-yl)piperidin-1-yl]-(3-fluorophenyl)methanone.
| Compound Name | [4-(14,14-dimethyl-2,16-dioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-10-yl)piperidin-1-yl]-(3-fluorophenyl)methanone |
|---|---|
| PubChem CID | 110071973 |
| Molecular Formula | C31H36FN3O3 |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.27 |
| IUPAC Name | [4-(14,14-dimethyl-2,16-dioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-10-yl)piperidin-1-yl]-(3-fluorophenyl)methanone |
| SMILES | CC1(C)CCCN(C2CCN(C(=O)c3cccc(F)c3)CC2)Cc2cccnc2Oc2ccccc2OC1 |
| InChI | InChI=1S/C31H36FN3O3/c1-31(2)15-7-17-35(26-13-18-34(19-14-26)30(36)23-8-5-10-25(32)20-23)21-24-9-6-16-33-29(24)38-28-12-4-3-11-27(28)37-22-31/h3-6,8-12,16,20,26H,7,13-15,17-19,21-22H2,1-2H3 |
| InChIKey | HTUQGEJJGUVXOV-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |