C26H35N3O4 — CID 110070979
2-(14,14-dimethyl-2,16-dioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-10-yl)-N-(oxan-4-yl)acetamide (PubChem CID 110070979) has the molecular formula C26H35N3O4 and a molecular weight of 453.58 g/mol. Its IUPAC name is 2-(14,14-dimethyl-2,16-dioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-10-yl)-N-(oxan-4-yl)acetamide.
| Compound Name | 2-(14,14-dimethyl-2,16-dioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-10-yl)-N-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 110070979 |
| Molecular Formula | C26H35N3O4 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.26 |
| IUPAC Name | 2-(14,14-dimethyl-2,16-dioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-10-yl)-N-(oxan-4-yl)acetamide |
| SMILES | CC1(C)CCCN(CC(=O)NC2CCOCC2)Cc2cccnc2Oc2ccccc2OC1 |
| InChI | InChI=1S/C26H35N3O4/c1-26(2)12-6-14-29(18-24(30)28-21-10-15-31-16-11-21)17-20-7-5-13-27-25(20)33-23-9-4-3-8-22(23)32-19-26/h3-5,7-9,13,21H,6,10-12,14-19H2,1-2H3,(H,28,30) |
| InChIKey | WMVJQWACDRGMIJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |