C25H31N5O3 — CID 175657154
2-(2,17-dioxa-4,10-diazatricyclo[16.4.0.03,8]docosa-1(22),3(8),4,6,18,20-hexaen-10-yl)-N-[(5-methyl-1H-pyrazol-3-yl)methyl]acetamide (PubChem CID 175657154) has the molecular formula C25H31N5O3 and a molecular weight of 449.56 g/mol. Its IUPAC name is 2-(2,17-dioxa-4,10-diazatricyclo[16.4.0.03,8]docosa-1(22),3(8),4,6,18,20-hexaen-10-yl)-N-[(5-methyl-1H-pyrazol-3-yl)methyl]acetamide.
| Compound Name | 2-(2,17-dioxa-4,10-diazatricyclo[16.4.0.03,8]docosa-1(22),3(8),4,6,18,20-hexaen-10-yl)-N-[(5-methyl-1H-pyrazol-3-yl)methyl]acetamide |
|---|---|
| PubChem CID | 175657154 |
| Molecular Formula | C25H31N5O3 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | 2-(2,17-dioxa-4,10-diazatricyclo[16.4.0.03,8]docosa-1(22),3(8),4,6,18,20-hexaen-10-yl)-N-[(5-methyl-1H-pyrazol-3-yl)methyl]acetamide |
| SMILES | Cc1cc(CNC(=O)CN2CCCCCCOc3ccccc3Oc3ncccc3C2)n[nH]1 |
| InChI | InChI=1S/C25H31N5O3/c1-19-15-21(29-28-19)16-27-24(31)18-30-13-6-2-3-7-14-32-22-10-4-5-11-23(22)33-25-20(17-30)9-8-12-26-25/h4-5,8-12,15H,2-3,6-7,13-14,16-18H2,1H3,(H,27,31)(H,28,29) |
| InChIKey | SKRQJUIEJPIZSN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |