C25H26ClN3O3 — CID 110070908
N-(3-chlorophenyl)-2-(2,16-dioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-10-yl)acetamide (PubChem CID 110070908) has the molecular formula C25H26ClN3O3 and a molecular weight of 451.95 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-(2,16-dioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-10-yl)acetamide.
| Compound Name | N-(3-chlorophenyl)-2-(2,16-dioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-10-yl)acetamide |
|---|---|
| PubChem CID | 110070908 |
| Molecular Formula | C25H26ClN3O3 |
| Molecular Weight | 451.95 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | N-(3-chlorophenyl)-2-(2,16-dioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-10-yl)acetamide |
| SMILES | O=C(CN1CCCCCOc2ccccc2Oc2ncccc2C1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C25H26ClN3O3/c26-20-9-6-10-21(16-20)28-24(30)18-29-14-4-1-5-15-31-22-11-2-3-12-23(22)32-25-19(17-29)8-7-13-27-25/h2-3,6-13,16H,1,4-5,14-15,17-18H2,(H,28,30) |
| InChIKey | GEZMOYKFEFKKRY-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.95 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |