C26H29N3O4 — CID 110070910
2-(2,16-dioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-10-yl)-N-(3-methoxyphenyl)acetamide (PubChem CID 110070910) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is 2-(2,16-dioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-10-yl)-N-(3-methoxyphenyl)acetamide.
| Compound Name | 2-(2,16-dioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-10-yl)-N-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 110070910 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 2-(2,16-dioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-10-yl)-N-(3-methoxyphenyl)acetamide |
| SMILES | COc1cccc(NC(=O)CN2CCCCCOc3ccccc3Oc3ncccc3C2)c1 |
| InChI | InChI=1S/C26H29N3O4/c1-31-22-11-7-10-21(17-22)28-25(30)19-29-15-5-2-6-16-32-23-12-3-4-13-24(23)33-26-20(18-29)9-8-14-27-26/h3-4,7-14,17H,2,5-6,15-16,18-19H2,1H3,(H,28,30) |
| InChIKey | VHTCIUVCVRRLDC-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |