C28H33N3O4 — CID 110070994
2-(14,14-dimethyl-2,16-dioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-10-yl)-N-(3-methoxyphenyl)acetamide (PubChem CID 110070994) has the molecular formula C28H33N3O4 and a molecular weight of 475.59 g/mol. Its IUPAC name is 2-(14,14-dimethyl-2,16-dioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-10-yl)-N-(3-methoxyphenyl)acetamide.
| Compound Name | 2-(14,14-dimethyl-2,16-dioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-10-yl)-N-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 110070994 |
| Molecular Formula | C28H33N3O4 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | 2-(14,14-dimethyl-2,16-dioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-10-yl)-N-(3-methoxyphenyl)acetamide |
| SMILES | COc1cccc(NC(=O)CN2CCCC(C)(C)COc3ccccc3Oc3ncccc3C2)c1 |
| InChI | InChI=1S/C28H33N3O4/c1-28(2)14-8-16-31(19-26(32)30-22-10-6-11-23(17-22)33-3)18-21-9-7-15-29-27(21)35-25-13-5-4-12-24(25)34-20-28/h4-7,9-13,15,17H,8,14,16,18-20H2,1-3H3,(H,30,32) |
| InChIKey | USSRPQUAJPQSBN-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |