C33H36N4O4 — CID 110071007
2-(14,14-dimethyl-2,16-dioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-10-yl)-N-[(4-pyridin-3-yloxyphenyl)methyl]acetamide (PubChem CID 110071007) has the molecular formula C33H36N4O4 and a molecular weight of 552.68 g/mol. Its IUPAC name is 2-(14,14-dimethyl-2,16-dioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-10-yl)-N-[(4-pyridin-3-yloxyphenyl)methyl]acetamide.
| Compound Name | 2-(14,14-dimethyl-2,16-dioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-10-yl)-N-[(4-pyridin-3-yloxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 110071007 |
| Molecular Formula | C33H36N4O4 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.27 |
| IUPAC Name | 2-(14,14-dimethyl-2,16-dioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-10-yl)-N-[(4-pyridin-3-yloxyphenyl)methyl]acetamide |
| SMILES | CC1(C)CCCN(CC(=O)NCc2ccc(Oc3cccnc3)cc2)Cc2cccnc2Oc2ccccc2OC1 |
| InChI | InChI=1S/C33H36N4O4/c1-33(2)16-7-19-37(22-26-8-5-18-35-32(26)41-30-11-4-3-10-29(30)39-24-33)23-31(38)36-20-25-12-14-27(15-13-25)40-28-9-6-17-34-21-28/h3-6,8-15,17-18,21H,7,16,19-20,22-24H2,1-2H3,(H,36,38) |
| InChIKey | FVHNPBHKILHCAY-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |