C26H30N2O4S — CID 110077699
3-[[1-[2-(4-butoxyanilino)-2-oxoethyl]pyrrolidin-2-yl]methyl]-1-benzothiophene-2-carboxylic acid (PubChem CID 110077699) has the molecular formula C26H30N2O4S and a molecular weight of 466.60 g/mol. Its IUPAC name is 3-[[1-[2-(4-butoxyanilino)-2-oxoethyl]pyrrolidin-2-yl]methyl]-1-benzothiophene-2-carboxylic acid.
| Compound Name | 3-[[1-[2-(4-butoxyanilino)-2-oxoethyl]pyrrolidin-2-yl]methyl]-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 110077699 |
| Molecular Formula | C26H30N2O4S |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 3-[[1-[2-(4-butoxyanilino)-2-oxoethyl]pyrrolidin-2-yl]methyl]-1-benzothiophene-2-carboxylic acid |
| SMILES | CCCCOc1ccc(NC(=O)CN2CCCC2Cc2c(C(=O)O)sc3ccccc23)cc1 |
| InChI | InChI=1S/C26H30N2O4S/c1-2-3-15-32-20-12-10-18(11-13-20)27-24(29)17-28-14-6-7-19(28)16-22-21-8-4-5-9-23(21)33-25(22)26(30)31/h4-5,8-13,19H,2-3,6-7,14-17H2,1H3,(H,27,29)(H,30,31) |
| InChIKey | NEDKFVUBIDUTAE-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|