C5H11N3O — CID 11007925
1-(3-amino-4,5-dihydro-1H-pyrazol-4-yl)ethanol (PubChem CID 11007925) has the molecular formula C5H11N3O and a molecular weight of 129.16 g/mol. Its IUPAC name is 1-(3-amino-4,5-dihydro-1H-pyrazol-4-yl)ethanol.
| Compound Name | 1-(3-amino-4,5-dihydro-1H-pyrazol-4-yl)ethanol |
|---|---|
| PubChem CID | 11007925 |
| Molecular Formula | C5H11N3O |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.09 |
| IUPAC Name | 1-(3-amino-4,5-dihydro-1H-pyrazol-4-yl)ethanol |
| SMILES | CC(O)C1CNN=C1N |
| InChI | InChI=1S/C5H11N3O/c1-3(9)4-2-7-8-5(4)6/h3-4,7,9H,2H2,1H3,(H2,6,8) |
| InChIKey | DCAUJGRVUSKYTL-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |