C5H9NO2 — CID 68917580
(3R)-3-(1-hydroxyethyl)azetidin-2-one (PubChem CID 68917580) has the molecular formula C5H9NO2 and a molecular weight of 115.13 g/mol. Its IUPAC name is (3R)-3-(1-hydroxyethyl)azetidin-2-one.
| Compound Name | (3R)-3-(1-hydroxyethyl)azetidin-2-one |
|---|---|
| PubChem CID | 68917580 |
| Molecular Formula | C5H9NO2 |
| Molecular Weight | 115.13 g/mol |
| Exact Mass | 115.06 |
| IUPAC Name | (3R)-3-(1-hydroxyethyl)azetidin-2-one |
| SMILES | CC(O)[C@H]1CNC1=O |
| InChI | InChI=1S/C5H9NO2/c1-3(7)4-2-6-5(4)8/h3-4,7H,2H2,1H3,(H,6,8)/t3?,4-/m1/s1 |
| InChIKey | UMHGAVAUBIVOAL-SRBOSORUSA-N |
| XLogP | -0.89 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.13 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |