C5H10N2O — CID 54597772
(3S)-3-[(1S)-1-aminoethyl]azetidin-2-one (PubChem CID 54597772) has the molecular formula C5H10N2O and a molecular weight of 114.15 g/mol. Its IUPAC name is (3S)-3-[(1S)-1-aminoethyl]azetidin-2-one.
| Compound Name | (3S)-3-[(1S)-1-aminoethyl]azetidin-2-one |
|---|---|
| PubChem CID | 54597772 |
| Molecular Formula | C5H10N2O |
| Molecular Weight | 114.15 g/mol |
| Exact Mass | 114.08 |
| IUPAC Name | (3S)-3-[(1S)-1-aminoethyl]azetidin-2-one |
| SMILES | C[C@H](N)[C@@H]1CNC1=O |
| InChI | InChI=1S/C5H10N2O/c1-3(6)4-2-7-5(4)8/h3-4H,2,6H2,1H3,(H,7,8)/t3-,4-/m0/s1 |
| InChIKey | HWCQWRRZOHZWPH-IMJSIDKUSA-N |
| XLogP | -0.92 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.15 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |