C13H14F3N5 — CID 110089624
7-piperidin-3-yl-5-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-amine (PubChem CID 110089624) has the molecular formula C13H14F3N5 and a molecular weight of 297.28 g/mol. Its IUPAC name is 7-piperidin-3-yl-5-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-piperidin-3-yl-5-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 110089624 |
| Molecular Formula | C13H14F3N5 |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 7-piperidin-3-yl-5-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-amine |
| SMILES | Nc1ncnc2nc(C3CCCNC3)cc(C(F)(F)F)c12 |
| InChI | InChI=1S/C13H14F3N5/c14-13(15,16)8-4-9(7-2-1-3-18-5-7)21-12-10(8)11(17)19-6-20-12/h4,6-7,18H,1-3,5H2,(H2,17,19,20,21) |
| InChIKey | GIAXFAGYERJUQW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |